Molecule FYI-1006778

Home > Molecule

A

Molecule Summary:

ID: FYI-1006778
Names: ANILINE;
InChIKey: PAYRUJLWNCNPSJ-UHFFFAOYSA-N
SMILES: Nc1ccccc1

Received at FYIcenter.com on: 2024-01-15

Molecule ID: FYI-1006778 Edit

Molecule Names: ANILINE;

Molecule Structure InChIKey: PAYRUJLWNCNPSJ-UHFFFAOYSA-N

Molecule Structure SMILES String: Nc1ccccc1

Download SDF Download SVG Structure in 2D SDF:

FYI-1006778
FYIcenter.com

  7  7  0  0  0  0  0  0  0  0999 V2000
    3.6373    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  7  2  1  0  0  0  0
M  END
$$$$

Download SDF Structure in 3D SDF:

FYI-1006778-3D
FYIcenter.com

 14 14  0     0  0  0  0  0  0999 V2000
   -2.4046    0.0000    0.0005 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9941   -0.0002   -0.0003 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2969    1.2079   -0.0003 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2965   -1.2080   -0.0003 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0980    1.2080    0.0001 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0984   -1.2078    0.0001 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7957    0.0002    0.0003 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8289    2.1558   -0.0003 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8283   -2.1561   -0.0002 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6411    2.1486    0.0002 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6417   -2.1482    0.0002 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8818    0.0004    0.0006 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9109   -0.8755   -0.0005 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9107    0.8756   -0.0006 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 13  1  0  0  0  0
  1 14  1  0  0  0  0
  2  3  2  0  0  0  0
  2  4  1  0  0  0  0
  3  5  1  0  0  0  0
  3  8  1  0  0  0  0
  4  6  2  0  0  0  0
  4  9  1  0  0  0  0
  5  7  2  0  0  0  0
  5 10  1  0  0  0  0
  6  7  1  0  0  0  0
  6 11  1  0  0  0  0
  7 12  1  0  0  0  0
M  END
$$$$

✍: FYIcenter.com

2024-01-24, 2736👍, 0💬

Molecule FYI-1006781
Molecule Summary: ID: FYI-1006781 Names: InChIKey: XLOVNJUCAFIANM-UHFFFAOYSA-N SMILES: COC(=O)c1ccc(S(N)(=O)=O)cc1 Received at FYIcenter.com on: 2024-01-15 2024-01-24, 1837🔥, 0💬

Molecule FYI-1006777
Molecule Summary: ID: FYI-1006777 Names: InChIKey: ZYIFLKPDFLWFAE-UHFFFAOYSA-N SMILES: Cc1ccccc1.Nc1ccccc1 Received at FYIcenter.com on: 2024-01-15 2024-01-24, 1744🔥, 0💬

Molecule FYI-1006782
Molecule Summary: ID: FYI-1006782 Names: InChIKey: XQVVPGYIWAGRNI-JOCHJYFZSA-O SMILES: CC[C@@H]4C(=O)N(C)c3cnc(Nc2ccc (C(=O)NC1CC[NH+](C)CC1)cc2OC)n c3N4C5CCCC5Received at FYIcenter.com on: 2024-01-15 2024-01-24, 1676🔥, 0💬

Molecule FYI-1006780
Molecule Summary: ID: FYI-1006780 Names: InChIKey: SMBREKYBPARCFW-UHFFFAOYSA-N SMILES: O=C(c1ccco1)N3CCN(C(=O)C2CC2)C C3Received at FYIcenter.com on: 2024-01-15 2024-01-24, 1593🔥, 0💬

Molecule FYI-1006779
Molecule Summary: ID: FYI-1006779 Names: InChIKey: LOPAFWMOCZGHFX-UHFFFAOYSA-N SMILES: c3cc(c2ccc1OCOc1c2)n[nH]3 Received at FYIcenter.com on: 2024-01-15 2024-01-24, 1570🔥, 0💬

Molecule FYI-1006783
Molecule Summary: ID: FYI-1006783 Names: InChIKey: FKECTEOJUWKREV-ABZVBJSCSA-N SMILES: CC(C)(O)/C=C/c3ccc(C(=O)N2CC[C @@](Cc1ccccc1)(C(=O)O)[C@@H](O )C2)cc3Received at FYIcenter.com on: 2024-01-16 2024-01-24, 1438🔥, 0💬

Adding Text Labels in Ketcher File
How to add text labels in a Ketcher file? You can insert a "text" object structure into the "nodes" array to add a text label in a Ketcher file as shown below: { "type": "text", "data": { "content": <text-definition&gt ;,"position": <location-object&gt ;,"pos": <bounding... 2024-02-28, 930🔥, 0💬

Ketcher File Structure for Reaction
What is the Ketcher file structure for a chemical reaction? The Ketcher file structure for a chemical reaction is an extension of the Ketcher file structure for a molecule. Additional molecule objects are added as reactants, reagents, solvents, and products of the reaction. A long arrow is also adde... 2024-02-18, 887🔥, 0💬

Molecule with Substituted Functional Group
How to specify a S-Group (Substituted Functional Group) in a molecule structure in Ketcher file format? There are 2 options to specify a S-Group (Substituted Functional Group) in a molecule structure: 1. Specify S-Group without Group Substructure: Just replace the atom symbol at the s-group attachin... 2024-02-28, 825🔥, 0💬

All rights in the contents of this web site are reserved by the individual author. fyicenter.com does not guarantee the truthfulness, accuracy, or reliability of any contents.