Molecule FYI-1004047

Molecule Summary:

ID: FYI-1004047
Names:
InChIKey: CLKOFPXJLQSYAH-ABRJDSQDSA-N
SMILES: CC[C@H](C)[C@H](N)C4=N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@H]3CCCCNC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](Cc2ccccc2)NC(=O)C([C@@H](C)CC)NC(=O)[C@@H](CCCN)NC3=O)[C@@H](C)CC)CS4

Received at FYIcenter.com on: 2023-08-08

Molecule ID: FYI-1004047 Edit

Molecule Structure InChIKey: CLKOFPXJLQSYAH-ABRJDSQDSA-N

Molecule Structure SMILES String: CC[C@H](C)[C@H](N)C4=N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@H]3CCCCNC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](CC(=O)O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](Cc2ccccc2)NC(=O)C([C@@H](C)CC)NC(=O)[C@@H](CCCN)NC3=O)[C@@H](C)CC)CS4

Download SDF Download SVG Structure in 2D SDF:

Image not available

FYI-1004047
FYIcenter.com

203206  0  0  1  0  0  0  0  0999 V2000
   36.5077   18.4991    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.1317   12.4392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2888    7.6428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1593    3.9160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4152    9.1508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8690    4.7106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9043   14.3040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1871   15.4589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8273    9.5960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1866   17.6806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1878   20.2641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2624   17.0589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2255   15.9239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8474   20.2641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1311   21.1756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2247   20.4402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5372   17.4669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2079    9.5960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4147   11.3725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0176    5.3715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7312    7.2377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9806   11.4607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1874   13.2372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3040    7.2377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7995   15.7216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0649   17.8278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3936   16.0003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1455   11.8248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.4492    3.1258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1546   19.0885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7122   16.6464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7107   12.7087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3484    9.9898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9386   23.5570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1321   10.2177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4910    8.5293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5663   10.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3052    5.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8760    3.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8897   11.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3348    6.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1326    7.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4905   10.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3389   11.9941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7814   13.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2084    7.3744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8315    8.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1664    4.7106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9048   12.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1092    2.7085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7300    5.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0563   10.8392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2636   10.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2480   15.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7004    6.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2135    3.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9052    9.8606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9801   13.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8919    4.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2632   12.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4914    6.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0812   18.9736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3791   17.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1113   16.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2039    8.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3232   16.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6800    1.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6625   17.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8285   14.9256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9308   17.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2629   14.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7977   19.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7235    3.1621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7466    7.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2641    8.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1878   11.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0667   20.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4689   10.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2539   13.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4997   20.7308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8187    5.9183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8806   19.0885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5524   18.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9040   16.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5584   13.8710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7872   15.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9703   17.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0971   20.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3483    5.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3615    4.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4828   18.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4306   12.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9557   19.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4207    3.3942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4338    3.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7221   21.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9634    2.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8249   10.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2392   19.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0418   11.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9096   11.2643    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.7134    7.4826    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.9914    9.1472    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.1299    4.3744    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1113    4.6647    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.7555   11.1958    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.8217   11.8921    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.3793    5.9898    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.2020    8.0332    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.2814    9.0557    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.4304    8.5493    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.1922   12.4192    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.1343   12.7102    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.7764   13.1535    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.7302   13.3469    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.4922    8.1696    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.4130    6.6583    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.9243    6.5791    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.1533    4.3658    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.3301    3.6531    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.6823   13.1289    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0837    2.2663    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.7138    3.5913    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0176    4.3014    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.4637    6.4577    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.1942   10.3566    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.1147    9.3343    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.3097   15.0548    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.2797   14.7333    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9257    4.4826    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1829    3.1641    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.5014    2.4211    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.1099    9.1446    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.4131   14.5898    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.9880   13.2815    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.2030   10.4139    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.9051    5.0194    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.7283    5.7321    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.4446    6.0851    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.7139    5.2609    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.5381    6.5300    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.0169   18.8617    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.9439   16.4192    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.3882   15.0467    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0365    7.5108    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.2052   12.9065    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5715    6.4577    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.3849   16.7805    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.4987   15.9643    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.6435    1.3028    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4138    0.0000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.7164    0.7705    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.6001   18.8148    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.8841   17.5745    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.8299   13.9298    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.2550   15.2381    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.7230   18.0864    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.8361   18.8950    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.7105    2.8172    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.8872    2.1045    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3387    8.6322    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7013    7.4131    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.2172    7.9499    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.4865    7.1255    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.3107    8.3948    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.9040   10.2203    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   36.9832   11.7316    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.4717   11.8108    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.9324   20.9989    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.4377   21.2357    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.2009   19.7410    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.6939   18.6936    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4083   12.8916    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.4579   16.1122    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.9583   15.0227    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0776   11.7576    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   43.4773   20.2955    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.9350   21.7085    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.5221   21.1660    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1730   19.8913    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9385   14.8712    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6393   14.4188    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.9648    2.1881    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.0036    4.0413    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9050   17.9285    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.0205   20.1504    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.1192   20.4845    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.5860   21.7528    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8875   17.3285    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2519    5.6921    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4132    5.4892    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.9176   19.6933    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6608   20.2529    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3691    2.8983    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5302    2.6955    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.9642   18.7273    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0083    1.4001    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1563   13.6241    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8113   10.4692    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   10.8732    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.0861   24.2039    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.9250   23.9716    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1604   20.3283    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1 68  1  0  0  0  0
  1 70  1  0  0  0  0
  2 43  2  0  0  0  0
  3 47  2  0  0  0  0
  4 51  2  0  0  0  0
  5 52  2  0  0  0  0
  6 55  2  0  0  0  0
  7 60  2  0  0  0  0
  8 69  2  0  0  0  0
  9 78  2  0  0  0  0
 10 84  1  0  0  0  0
 10196  1  0  0  0  0
 11 83  2  0  0  0  0
 12 84  2  0  0  0  0
 13 86  2  0  0  0  0
 14 91  2  0  0  0  0
 15 96  2  0  0  0  0
 16 99  1  0  0  0  0
 16203  1  0  0  0  0
 17 99  2  0  0  0  0
 37 18  1  6  0  0  0
 18 43  1  0  0  0  0
 18111  1  0  0  0  0
 35 19  1  1  0  0  0
 19 52  1  0  0  0  0
 19112  1  0  0  0  0
 20 38  1  0  0  0  0
 20 51  1  0  0  0  0
 20124  1  0  0  0  0
 21 41  1  0  0  0  0
 21 47  1  0  0  0  0
 21125  1  0  0  0  0
 44 22  1  1  0  0  0
 22 60  1  0  0  0  0
 22136  1  0  0  0  0
 49 23  1  1  0  0  0
 23 69  1  0  0  0  0
 23146  1  0  0  0  0
 24 55  1  0  0  0  0
 24 65  1  0  0  0  0
 24147  1  0  0  0  0
 25 64  1  0  0  0  0
 25 68  2  0  0  0  0
 26 66  1  0  0  0  0
 26 83  1  0  0  0  0
 26172  1  0  0  0  0
 63 27  1  6  0  0  0
 27174  1  0  0  0  0
 27175  1  0  0  0  0
 28 78  1  0  0  0  0
 28 79  1  0  0  0  0
 28176  1  0  0  0  0
 29 73  1  0  0  0  0
 29183  1  0  0  0  0
 29184  1  0  0  0  0
 30 82  1  0  0  0  0
 30 91  1  0  0  0  0
 30186  1  0  0  0  0
 31 86  1  0  0  0  0
 31 87  1  0  0  0  0
 31189  1  0  0  0  0
 32 92  1  0  0  0  0
 32100  1  0  0  0  0
 32198  1  0  0  0  0
 33 98  1  0  0  0  0
 33100  2  0  0  0  0
 34 96  1  0  0  0  0
 34201  1  0  0  0  0
 34202  1  0  0  0  0
 35 36  1  0  0  0  0
 35 43  1  0  0  0  0
 35101  1  0  0  0  0
 36 42  1  0  0  0  0
 36 46  1  6  0  0  0
 36102  1  0  0  0  0
 37 40  1  0  0  0  0
 37 47  1  0  0  0  0
 37103  1  0  0  0  0
 38 39  1  0  0  0  0
 38 55  1  0  0  0  0
 38104  1  6  0  0  0
 39 50  1  0  0  0  0
 39 56  1  6  0  0  0
 39105  1  0  0  0  0
 40 45  1  0  0  0  0
 40106  1  0  0  0  0
 40107  1  0  0  0  0
 41 48  1  6  0  0  0
 41 51  1  0  0  0  0
 41108  1  0  0  0  0
 42 61  1  0  0  0  0
 42109  1  0  0  0  0
 42110  1  0  0  0  0
 44 52  1  0  0  0  0
 44 58  1  0  0  0  0
 44113  1  0  0  0  0
 45 54  1  0  0  0  0
 45114  1  0  0  0  0
 45115  1  0  0  0  0
 46116  1  0  0  0  0
 46117  1  0  0  0  0
 46118  1  0  0  0  0
 48 59  1  0  0  0  0
 48119  1  0  0  0  0
 48120  1  0  0  0  0
 49 53  1  0  0  0  0
 49 60  1  0  0  0  0
 49121  1  0  0  0  0
 50 67  1  0  0  0  0
 50122  1  0  0  0  0
 50123  1  0  0  0  0
 53 57  1  0  0  0  0
 53126  1  0  0  0  0
 53127  1  0  0  0  0
 54 66  1  0  0  0  0
 54128  1  0  0  0  0
 54129  1  0  0  0  0
 56130  1  0  0  0  0
 56131  1  0  0  0  0
 56132  1  0  0  0  0
 57 75  1  0  0  0  0
 57 76  1  0  0  0  0
 57133  1  0  0  0  0
 58 71  1  0  0  0  0
 58134  1  0  0  0  0
 58135  1  0  0  0  0
 59 73  1  0  0  0  0
 59137  1  0  0  0  0
 59138  1  0  0  0  0
 61139  1  0  0  0  0
 61140  1  0  0  0  0
 61141  1  0  0  0  0
 62 63  1  0  0  0  0
 62 72  1  0  0  0  0
 62 77  1  1  0  0  0
 62142  1  0  0  0  0
 63 68  1  0  0  0  0
 63143  1  0  0  0  0
 64 69  1  6  0  0  0
 64 70  1  0  0  0  0
 64144  1  0  0  0  0
 65 74  1  6  0  0  0
 65 78  1  0  0  0  0
 65145  1  0  0  0  0
 66148  1  0  0  0  0
 66149  1  0  0  0  0
 67150  1  0  0  0  0
 67151  1  0  0  0  0
 67152  1  0  0  0  0
 70153  1  0  0  0  0
 70154  1  0  0  0  0
 71 84  1  0  0  0  0
 71155  1  0  0  0  0
 71156  1  0  0  0  0
 72 80  1  0  0  0  0
 72157  1  0  0  0  0
 72158  1  0  0  0  0
 73159  1  0  0  0  0
 73160  1  0  0  0  0
 74 81  1  0  0  0  0
 74161  1  0  0  0  0
 74162  1  0  0  0  0
 75163  1  0  0  0  0
 75164  1  0  0  0  0
 75165  1  0  0  0  0
 76166  1  0  0  0  0
 76167  1  0  0  0  0
 76168  1  0  0  0  0
 77169  1  0  0  0  0
 77170  1  0  0  0  0
 77171  1  0  0  0  0
 79 85  1  1  0  0  0
 79 86  1  0  0  0  0
 79173  1  0  0  0  0
 80177  1  0  0  0  0
 80178  1  0  0  0  0
 80179  1  0  0  0  0
 81 89  2  0  0  0  0
 81 90  1  0  0  0  0
 82 83  1  0  0  0  0
 82 88  1  1  0  0  0
 82180  1  0  0  0  0
 85 92  1  0  0  0  0
 85181  1  0  0  0  0
 85182  1  0  0  0  0
 87 91  1  0  0  0  0
 87 93  1  6  0  0  0
 87185  1  0  0  0  0
 88 96  1  0  0  0  0
 88187  1  0  0  0  0
 88188  1  0  0  0  0
 89 94  1  0  0  0  0
 89190  1  0  0  0  0
 90 95  2  0  0  0  0
 90191  1  0  0  0  0
 92 98  2  0  0  0  0
 93 99  1  0  0  0  0
 93192  1  0  0  0  0
 93193  1  0  0  0  0
 94 97  2  0  0  0  0
 94194  1  0  0  0  0
 95 97  1  0  0  0  0
 95195  1  0  0  0  0
 97197  1  0  0  0  0
 98199  1  0  0  0  0
100200  1  0  0  0  0
M  END
$$$$

Download SDF Structure in 3D SDF:

FYI-1004047-3D
FYIcenter.com

        <meta http-equiv="Content-Type" content="text/html; charset=UTF-8"/>
        <link rel="stylesheet" href="./SP_down/nwds.2b297fc25828.css"/>
        <link rel="stylesheet" href="./SP_down/uswds.053a2e840adc.css"/>
        <link rel="stylesheet" href="./SP_down/header.0a45ab6073a4.css"/>
        <link rel="stylesheet" href="./SP_down/footer.dce7b046ef03.css"/>
        <title>NCBI | NLM | NIH</title>
       	<style type="text/css">
			body {
				display: flex; 
				flex-direction: column;
				height: 100%;
			}
			header {
				flex-shrink: 0;
			}
			main {
				flex-grow: 1;
				flex-shrink: 0;
			}
		</style>
    </head>
    <body>
        <div class="usa-overlay"></div>
        <header class="ncbi-header" role="banner" data-section="Header">
        <div class="usa-grid">
            <div class="usa-width-one-whole">
                
                <div class="ncbi-header__logo">
                    <a href="https://www.ncbi.nlm.nih.gov/" class="logo" aria-label="NCBI Logo">
                        <img src="https://www.ncbi.nlm.nih.gov/coreutils/nwds/img/logos/AgencyLogo.svg" alt="NIH NLM Logo"/>
                    </a>
                </div>
            </div>
        </div>
    </header>
    <main id="main_content">
     <section class="usa-section usa-grid">
        <h3><strong>Maintenance in progress</strong></h3>
        <p>
The page you are trying to reach is currently unavailable due to planned
maintenance. Most services will be unavailable for 24+ hours starting 9 PM EDT
on Friday, July 25, 2025.<br><br>
For more information, please visit
<a href="https://ncbiinsights.ncbi.nlm.nih.gov/2025/07/08/ncbi-website-maintenance-july-26th/">
NCBI Insights</a>
        </p>
     </section>
    </main>
    <footer>
       <section class="icon-selection">
          <div id="icon-section-header" class="icon-section_header">Follow NCBI</div>
            <div class="grid-container container">
              <div class="icon-section_container">
                <a class="footer-icon" id="footer_twitter" href="https://twitter.com/ncbi" aria-label="Twitter">
                    <svg width="40" height="40" viewBox="0 0 40 37" fill="none" xmlns="http://www.w3.org/2000/svg">
                        <title>Twitter</title>
                        <g id="twitterx1008">
                        <path id="path1008" d="M6.06736 7L16.8778 20.8991L6.00001 32.2H10.2L18.6 23.1L25.668 32.2H34L22.8 17.5L31.9 7H28.4L20.7 15.4L14.401 7H6.06898H6.06736ZM9.66753 8.73423H12.9327L29.7327 30.4658H26.5697L9.66753 8.73423Z" fill="#5B616B"></path> </g>
                    </svg>
                </a>
                <a class="footer-icon" id="footer_facebook" href="https://www.facebook.com/ncbi.nlm" aria-label="Facebook"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <title>Facebook</title>
                    <path class="cls-11" d="M210.5,115.12H171.74V97.82c0-8.14,5.39-10,9.19-10h27.14V52l-39.32-.12c-35.66,0-42.42,26.68-42.42,43.77v19.48H99.09v36.32h27.24v109h45.41v-109h35Z">
                    </path>
                  </svg></a>
                <a class="footer-icon" id="footer_linkedin" href="https://www.linkedin.com/company/ncbinlm" aria-label="LinkedIn"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <title>LinkedIn</title>
                    <path class="cls-11" d="M101.64,243.37H57.79v-114h43.85Zm-22-131.54h-.26c-13.25,0-21.82-10.36-21.82-21.76,0-11.65,8.84-21.15,22.33-21.15S101.7,78.72,102,90.38C102,101.77,93.4,111.83,79.63,111.83Zm100.93,52.61A17.54,17.54,0,0,0,163,182v61.39H119.18s.51-105.23,0-114H163v13a54.33,54.33,0,0,1,34.54-12.66c26,0,44.39,18.8,44.39,55.29v58.35H198.1V182A17.54,17.54,0,0,0,180.56,164.44Z">
                    </path>
                  </svg></a>
                <a class="footer-icon" id="footer_github" href="https://github.com/ncbi" aria-label="GitHub"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <defs>
                      <style>
                        .cls-11,
                        .cls-12 {
                          fill: #737373;
                        }

                        .cls-11 {
                          fill-rule: evenodd;
                        }
                      </style>
                    </defs>
                    <title>GitHub</title>
                    <path class="cls-11" d="M151.36,47.28a105.76,105.76,0,0,0-33.43,206.1c5.28,1,7.22-2.3,7.22-5.09,0-2.52-.09-10.85-.14-19.69-29.42,6.4-35.63-12.48-35.63-12.48-4.81-12.22-11.74-15.47-11.74-15.47-9.59-6.56.73-6.43.73-6.43,10.61.75,16.21,10.9,16.21,10.9,9.43,16.17,24.73,11.49,30.77,8.79,1-6.83,3.69-11.5,6.71-14.14C108.57,197.1,83.88,188,83.88,147.51a40.92,40.92,0,0,1,10.9-28.39c-1.1-2.66-4.72-13.42,1-28,0,0,8.88-2.84,29.09,10.84a100.26,100.26,0,0,1,53,0C198,88.3,206.9,91.14,206.9,91.14c5.76,14.56,2.14,25.32,1,28a40.87,40.87,0,0,1,10.89,28.39c0,40.62-24.74,49.56-48.29,52.18,3.79,3.28,7.17,9.71,7.17,19.58,0,14.15-.12,25.54-.12,29,0,2.82,1.9,6.11,7.26,5.07A105.76,105.76,0,0,0,151.36,47.28Z">
                    </path>
                    <path class="cls-12" d="M85.66,199.12c-.23.52-1.06.68-1.81.32s-1.2-1.06-.95-1.59,1.06-.69,1.82-.33,1.21,1.07.94,1.6Zm-1.3-1">
                    </path>
                    <path class="cls-12" d="M90,203.89c-.51.47-1.49.25-2.16-.49a1.61,1.61,0,0,1-.31-2.19c.52-.47,1.47-.25,2.17.49s.82,1.72.3,2.19Zm-1-1.08">
                    </path>
                    <path class="cls-12" d="M94.12,210c-.65.46-1.71,0-2.37-.91s-.64-2.07,0-2.52,1.7,0,2.36.89.65,2.08,0,2.54Zm0,0"></path>
                    <path class="cls-12" d="M99.83,215.87c-.58.64-1.82.47-2.72-.41s-1.18-2.06-.6-2.7,1.83-.46,2.74.41,1.2,2.07.58,2.7Zm0,0">
                    </path>
                    <path class="cls-12" d="M107.71,219.29c-.26.82-1.45,1.2-2.64.85s-2-1.34-1.74-2.17,1.44-1.23,2.65-.85,2,1.32,1.73,2.17Zm0,0">
                    </path>
                    <path class="cls-12" d="M116.36,219.92c0,.87-1,1.59-2.24,1.61s-2.29-.68-2.3-1.54,1-1.59,2.26-1.61,2.28.67,2.28,1.54Zm0,0">
                    </path>
                    <path class="cls-12" d="M124.42,218.55c.15.85-.73,1.72-2,1.95s-2.37-.3-2.52-1.14.73-1.75,2-2,2.37.29,2.53,1.16Zm0,0"></path>
                  </svg></a>
                <a class="footer-icon" id="footer_blog" href="https://ncbiinsights.ncbi.nlm.nih.gov/" aria-label="Blog">
                  <svg id="Layer_1" data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 40 40"><defs><style>.cls-1{fill:#737373;}</style></defs><path class="cls-1" d="M14,30a4,4,0,1,1-4-4,4,4,0,0,1,4,4Zm11,3A19,19,0,0,0,7.05,15a1,1,0,0,0-1,1v3a1,1,0,0,0,.93,1A14,14,0,0,1,20,33.07,1,1,0,0,0,21,34h3a1,1,0,0,0,1-1Zm9,0A28,28,0,0,0,7,6,1,1,0,0,0,6,7v3a1,1,0,0,0,1,1A23,23,0,0,1,29,33a1,1,0,0,0,1,1h3A1,1,0,0,0,34,33Z"></path></svg>
                </a>
              </div>
            </div>
        </section>
      <section class="container-fluid bg-primary">
        <div class="container pt-5">
          <div class="row mt-3">
            <div class="col-lg-3 col-12">
              <p><a class="text-white" href="https://www.nlm.nih.gov/socialmedia/index.html">Follow NLM</a></p>
              <ul class="list-inline social_media">
                  <li class="list-inline-item">
                      <a href="https://twitter.com/NLM_NIH" aria-label="Twitter" target="_blank" rel="noopener noreferrer">
                          <svg width="35" height="35" viewBox="0 0 38 35" fill="none" xmlns="http://www.w3.org/2000/svg">
                              <title>Twitter</title>
                              <g id="twitterx1009" clip-path="url(#clip0_65276_3946)">
                                 <path id="Vector" d="M17.5006 34.6565C26.9761 34.6565 34.6575 26.9751 34.6575 17.4996C34.6575 8.02416 26.9761 0.342773 17.5006 0.342773C8.02514 0.342773 0.34375 8.02416 0.34375 17.4996C0.34375 26.9751 8.02514 34.6565 17.5006 34.6565Z" fill="#205493" stroke="white" stroke-width="1.2" stroke-miterlimit="10"></path>
                                 <path id="path1009" d="M8.54811 8.5L16.2698 18.4279L8.50001 26.5H11.5L17.5 20L22.5486 26.5H28.5L20.5 16L27 8.5H24.5L19 14.5L14.5007 8.5H8.54927H8.54811ZM11.1197 9.73873H13.4519L25.4519 25.2613H23.1926L11.1197 9.73873Z" fill="white"></path>
                              </g>
                              <defs>
                              <clipPath id="clip0_65276_3946"> <rect width="38" height="38" fill="white"></rect> </clipPath>
                              </defs>
                          </svg>
                      </a>
                  </li>
                <li class="list-inline-item"><a href="https://www.facebook.com/nationallibraryofmedicine" aria-label="Facebook" rel="noopener noreferrer" target="_blank">
                  <svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" viewBox="0 0 249 249" style="enable-background:new 0 0 249 249;" xml:space="preserve">
                      <style type="text/css">
                        .st10 {
                          fill: #FFFFFF;
                        }

                        .st110 {
                          fill: none;
                          stroke: #FFFFFF;
                          stroke-width: 8;
                          stroke-miterlimit: 10;
                        }
                      </style>
                      <title>SM-Facebook</title>
                      <g>
                        <g>
                          <path class="st10" d="M159,99.1h-24V88.4c0-5,3.3-6.2,5.7-6.2h16.8V60l-24.4-0.1c-22.1,0-26.2,16.5-26.2,27.1v12.1H90v22.5h16.9
                                                      v67.5H135v-67.5h21.7L159,99.1z"></path>
                        </g>
                      </g>
                      <circle class="st110" cx="123.6" cy="123.2" r="108.2"></circle>
                    </svg>
                </a>
                </li>
                <li class="list-inline-item"><a href="https://www.youtube.com/user/NLMNIH" aria-label="Youtube" target="_blank" rel="noopener noreferrer"><svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" viewBox="0 0 249 249" style="enable-background:new 0 0 249 249;" xml:space="preserve">
                      <title>SM-Youtube</title>
                      <style type="text/css">
                        .st4 {
                          fill: none;
                          stroke: #FFFFFF;
                          stroke-width: 8;
                          stroke-miterlimit: 10;
                        }

                        .st5 {
                          fill: #FFFFFF;
                        }
                      </style>
                      <circle class="st4" cx="124.2" cy="123.4" r="108.2"></circle>
                      <g transform="translate(0,-952.36218)">
                        <path class="st5" d="M88.4,1037.4c-10.4,0-18.7,8.3-18.7,18.7v40.1c0,10.4,8.3,18.7,18.7,18.7h72.1c10.4,0,18.7-8.3,18.7-18.7
                                            v-40.1c0-10.4-8.3-18.7-18.7-18.7H88.4z M115.2,1058.8l29.4,17.4l-29.4,17.4V1058.8z"></path>
                      </g>
                    </svg></a></li>
              </ul>
            </div>
            <div class="col-lg-3 col-12">
              <p class="address_footer text-white">National Library of Medicine<br>
                <a href="https://www.google.com/maps/place/8600+Rockville+Pike,+Bethesda,+MD+20894/@38.9959508,-77.101021,17z/data=!3m1!4b1!4m5!3m4!1s0x89b7c95e25765ddb:0x19156f88b27635b8!8m2!3d38.9959508!4d-77.0988323" class="text-white" target="_blank" rel="noopener noreferrer">8600 Rockville Pike<br>
                  Bethesda, MD 20894</a></p>
            </div>
            <div class="col-lg-3 col-12 centered-lg">
              <p><a href="https://www.nlm.nih.gov/web_policies.html" class="text-white">Web Policies</a><br>
                <a href="https://www.nih.gov/institutes-nih/nih-office-director/office-communications-public-liaison/freedom-information-act-office" class="text-white">FOIA</a><br>
                <a href="https://www.hhs.gov/vulnerability-disclosure-policy/index.html" class="text-white" id="vdp">HHS Vulnerability Disclosure</a></p>
            </div>
            <div class="col-lg-3 col-12 centered-lg">
              <p><a class="supportLink text-white" href="https://support.nlm.nih.gov/">Help</a><br>
                <a href="https://www.nlm.nih.gov/accessibility.html" class="text-white">Accessibility</a><br>
                <a href="https://www.nlm.nih.gov/careers/careers.html" class="text-white">Careers</a></p>
            </div>
          </div>
          <div class="row">
            <div class="col-lg-12 centered-lg">
              <nav class="bottom-links">
                <ul class="mt-3">
                  <li>
                    <a class="text-white" href="https://www.nlm.nih.gov/">NLM</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.nih.gov/">NIH</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.hhs.gov/">HHS</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.usa.gov/">USA.gov</a>
                  </li>
                </ul>
              </nav>
            </div>
          </div>
        </div>
      </section>
    </footer>
    </body>
</html>
M  END
$$$$

✍: FYIcenter.com

2023-09-05, 1882👍, 0💬