Molecule FYI-1006871

A

Molecule Summary:

ID: FYI-1006871
Names:
InChIKey: WEOYCCAEGSCXSP-LHQFLGLASA-O
SMILES: O=C(O)CC(=O)OCC%10O[C@@H](Oc2cc1c(O)cc(O)cc1[o+]c2c9cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c(O[C@@H]8O[C@H](COC(=O)/C=C/c7ccc(O[C@@H]6O[C@H](COC(=O)/C=C/c5ccc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc5)[C@@H](O)C(O)C6O)cc7)[C@@H](O)C(O)C8O)c9)C(O)[C@@H](O)[C@@H]%10O

Received at FYIcenter.com on: 2024-01-22

Molecule ID: FYI-1006871 Edit

Molecule Structure InChIKey: WEOYCCAEGSCXSP-LHQFLGLASA-O

Molecule Structure SMILES String: O=C(O)CC(=O)OCC%10O[C@@H](Oc2cc1c(O)cc(O)cc1[o+]c2c9cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c(O[C@@H]8O[C@H](COC(=O)/C=C/c7ccc(O[C@@H]6O[C@H](COC(=O)/C=C/c5ccc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc5)[C@@H](O)C(O)C6O)cc7)[C@@H](O)C(O)C8O)c9)C(O)[C@@H](O)[

Download SDF Download SVG Structure in 2D SDF:

Image not available

FYI-1006871
FYIcenter.com

180189  0  0  1  0  0  0  0  0999 V2000
   30.8275    9.2531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.3827    9.2531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4015   16.6622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1428    8.4299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6792    9.2531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8275   14.1925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9568   11.7228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7358   21.6016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9757    5.9602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8275    4.3137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6792    5.9602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.6603    8.4299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.6603   11.7228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8085   13.3693    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6792   19.1319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8275   20.7783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.6792   15.8389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8652    9.2531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8652    5.9602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5687    5.9602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7170    4.3137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5498    8.4299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1617   25.7177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0135   24.0713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2345    5.9602    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1617   19.1319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0135   20.7783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.5498   18.3086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2910   11.7228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.5310   15.8389    0.0000 O   0  3  0  0  0  0  0  0  0  0  0  0
    0.8840   23.2480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.8275   10.8996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1240   10.8996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8085    3.4905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2972   15.8338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.7170   14.1925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4026   20.8923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.0862    1.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2345    1.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4015    6.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8275    5.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4015    8.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533    6.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2345    9.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2345   10.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8085    8.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8085   11.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533   18.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8275   19.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533    8.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533   16.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4015   18.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3827   10.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8275   15.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2910    8.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2910    6.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7170    9.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7170    5.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1617   24.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   23.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1428    6.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9757    9.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7358   23.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   21.6016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8085    6.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1617   20.7783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9757   19.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7170   10.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6792   10.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533   13.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3100   24.0713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9568   13.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533   11.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1050   13.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5310   14.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1050   11.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6792   14.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3827   14.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9945    6.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3827   15.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9568   16.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   18.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1240    9.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2345    4.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4205    5.9602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9945    8.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2910   13.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8810   16.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9303   18.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0135   19.1319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   16.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6980    8.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6603    3.4905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8463    8.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8463    6.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4205    9.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2722    9.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8943   18.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4393   16.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4090   19.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8652   14.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4393   18.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0135   15.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8652   15.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6603    1.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5175    7.2938    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.9434    5.4498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.4015    9.4507    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533    5.7626    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.2345    8.2323    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   42.2345   11.9204    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.9245    7.9195    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.9245   12.2332    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.1373   17.7982    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.7115   19.6423    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   32.2533    9.4507    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.1373   17.1726    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.5175   17.7982    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.4987   10.3892    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.7115   15.3285    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4070    7.9195    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4070    7.2938    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6010    9.7635    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8328    5.4498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0458   24.5817    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5875   24.2688    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.1428    5.7626    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8517   22.7376    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.6318   10.0352    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.3196   10.0352    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4716   22.1120    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   39.8033    6.9607    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.4595    5.8242    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0458   20.2679    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   28.6318   19.9139    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.3196   19.9139    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.7222   10.7222    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.0660   11.8588    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   27.9757    4.9394    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   31.7115    3.8033    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.5633    6.4706    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   43.6603    7.4091    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   43.6603   12.7436    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9661   24.8533    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6537   24.8533    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.6927   13.8797    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.6792   20.1527    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.9434   21.2887    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.5633   16.3494    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   35.9892   11.2124    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.6792   15.2133    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9812    8.7427    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9812    6.4706    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8328    3.8033    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2777   26.2281    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0135   25.0921    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8975   21.2887    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.2668   13.6821    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.6658   18.8190    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   23.7584    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   29.9434   11.4100    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.4205    4.9394    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.1105    8.9403    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.0406   18.8772    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0135   20.1527    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7035   16.1518    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.6980    7.4091    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   44.6657    3.3132    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   44.0096    4.4497    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.7303    6.2730    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.4205   10.2739    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   22.2722   10.2739    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   41.7802   18.8954    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9812   13.6821    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3233   18.8190    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0135   14.8181    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.7491   16.3494    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   43.1871   16.3339    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   40.2848   21.4061    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   45.0862    0.0000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1 42  1  0  0  0  0
  1 50  1  0  0  0  0
  2 46  1  0  0  0  0
  2 53  1  0  0  0  0
  3 52  1  0  0  0  0
  3 54  1  0  0  0  0
  4 57  1  0  0  0  0
  4 61  1  0  0  0  0
 50  5  1  1  0  0  0
  5 69  1  0  0  0  0
 54  6  1  6  0  0  0
  6 70  1  0  0  0  0
 53  7  1  1  0  0  0
  7 72  1  0  0  0  0
  8 63  1  0  0  0  0
  8 66  1  0  0  0  0
 40  9  1  6  0  0  0
  9139  1  0  0  0  0
 10 41  1  0  0  0  0
 10140  1  0  0  0  0
 11 43  1  0  0  0  0
 11141  1  0  0  0  0
 44 12  1  6  0  0  0
 12142  1  0  0  0  0
 45 13  1  1  0  0  0
 13143  1  0  0  0  0
 14 47  1  0  0  0  0
 14146  1  0  0  0  0
 48 15  1  6  0  0  0
 15147  1  0  0  0  0
 49 16  1  1  0  0  0
 16148  1  0  0  0  0
 17 51  1  0  0  0  0
 17149  1  0  0  0  0
 55 18  1  6  0  0  0
 18152  1  0  0  0  0
 19 56  1  0  0  0  0
 19153  1  0  0  0  0
 61 20  1  1  0  0  0
 20 79  1  0  0  0  0
 21 58  1  0  0  0  0
 21154  1  0  0  0  0
 22 62  1  0  0  0  0
 22 83  1  0  0  0  0
 59 23  1  1  0  0  0
 23155  1  0  0  0  0
 60 24  1  6  0  0  0
 24156  1  0  0  0  0
 25 65  1  0  0  0  0
 25 84  1  0  0  0  0
 66 26  1  6  0  0  0
 26 82  1  0  0  0  0
 27 64  1  0  0  0  0
 27157  1  0  0  0  0
 28 67  1  0  0  0  0
 28159  1  0  0  0  0
 29 68  1  0  0  0  0
 29 87  1  0  0  0  0
 30 75  2  0  0  0  0
 30 81  1  0  0  0  0
 31 71  1  0  0  0  0
 31160  1  0  0  0  0
 32 73  1  0  0  0  0
 32161  1  0  0  0  0
 33 83  2  0  0  0  0
 34 84  2  0  0  0  0
 35 88  1  0  0  0  0
 35178  1  0  0  0  0
 36 87  2  0  0  0  0
 37100  1  0  0  0  0
 37179  1  0  0  0  0
 38105  1  0  0  0  0
 38180  1  0  0  0  0
 39105  2  0  0  0  0
 40 41  1  0  0  0  0
 40 42  1  0  0  0  0
 40106  1  0  0  0  0
 41 43  1  0  0  0  0
 41107  1  0  0  0  0
 42 62  1  1  0  0  0
 42108  1  0  0  0  0
 43 50  1  0  0  0  0
 43109  1  0  0  0  0
 44 45  1  0  0  0  0
 44 46  1  0  0  0  0
 44110  1  0  0  0  0
 45 47  1  0  0  0  0
 45111  1  0  0  0  0
 46 65  1  0  0  0  0
 46112  1  0  0  0  0
 47 53  1  0  0  0  0
 47113  1  0  0  0  0
 48 49  1  0  0  0  0
 48 51  1  0  0  0  0
 48114  1  0  0  0  0
 49 52  1  0  0  0  0
 49115  1  0  0  0  0
 50116  1  0  0  0  0
 51 54  1  0  0  0  0
 51117  1  0  0  0  0
 52 67  1  0  0  0  0
 52118  1  0  0  0  0
 53119  1  0  0  0  0
 54120  1  0  0  0  0
 55 56  1  0  0  0  0
 55 57  1  0  0  0  0
 55121  1  0  0  0  0
 56 58  1  0  0  0  0
 56122  1  0  0  0  0
 57 68  1  1  0  0  0
 57123  1  0  0  0  0
 58 61  1  0  0  0  0
 58124  1  0  0  0  0
 59 60  1  0  0  0  0
 59 63  1  0  0  0  0
 59125  1  0  0  0  0
 60 64  1  0  0  0  0
 60126  1  0  0  0  0
 61127  1  0  0  0  0
 62129  1  0  0  0  0
 62130  1  0  0  0  0
 63 71  1  0  0  0  0
 63128  1  0  0  0  0
 64 66  1  0  0  0  0
 64131  1  0  0  0  0
 65132  1  0  0  0  0
 65133  1  0  0  0  0
 66134  1  0  0  0  0
 67135  1  0  0  0  0
 67136  1  0  0  0  0
 68137  1  0  0  0  0
 68138  1  0  0  0  0
 69 73  1  0  0  0  0
 69 76  2  0  0  0  0
 70 73  2  0  0  0  0
 70 77  1  0  0  0  0
 71144  1  0  0  0  0
 71145  1  0  0  0  0
 72 75  1  0  0  0  0
 72 78  2  0  0  0  0
 74 75  1  0  0  0  0
 74 76  1  0  0  0  0
 74 77  2  0  0  0  0
 76150  1  0  0  0  0
 77151  1  0  0  0  0
 78 80  1  0  0  0  0
 78158  1  0  0  0  0
 79 85  2  0  0  0  0
 79 86  1  0  0  0  0
 80 81  1  0  0  0  0
 80 88  2  0  0  0  0
 81 89  2  0  0  0  0
 82 90  2  0  0  0  0
 82 91  1  0  0  0  0
 83 92  1  0  0  0  0
 84 93  1  0  0  0  0
 85 95  1  0  0  0  0
 85162  1  0  0  0  0
 86 96  2  0  0  0  0
 86163  1  0  0  0  0
 87101  1  0  0  0  0
 88 98  1  0  0  0  0
 89100  1  0  0  0  0
 89164  1  0  0  0  0
 90102  1  0  0  0  0
 90165  1  0  0  0  0
 91103  2  0  0  0  0
 91166  1  0  0  0  0
 92 97  2  0  0  0  0
 92167  1  0  0  0  0
 93105  1  0  0  0  0
 93168  1  0  0  0  0
 93169  1  0  0  0  0
 94 95  2  0  0  0  0
 94 96  1  0  0  0  0
 94 97  1  0  0  0  0
 95170  1  0  0  0  0
 96171  1  0  0  0  0
 97172  1  0  0  0  0
 98100  2  0  0  0  0
 98173  1  0  0  0  0
 99102  2  0  0  0  0
 99103  1  0  0  0  0
 99104  1  0  0  0  0
101104  2  0  0  0  0
101174  1  0  0  0  0
102175  1  0  0  0  0
103176  1  0  0  0  0
104177  1  0  0  0  0
M  END
$$$$

Download SDF Structure in 3D SDF:

FYI-1006871-3D
FYIcenter.com

        <meta http-equiv="Content-Type" content="text/html; charset=UTF-8"/>
        <link rel="stylesheet" href="./SP_down/nwds.2b297fc25828.css"/>
        <link rel="stylesheet" href="./SP_down/uswds.053a2e840adc.css"/>
        <link rel="stylesheet" href="./SP_down/header.0a45ab6073a4.css"/>
        <link rel="stylesheet" href="./SP_down/footer.dce7b046ef03.css"/>
        <title>NCBI | NLM | NIH</title>
       	<style type="text/css">
			body {
				display: flex; 
				flex-direction: column;
				height: 100%;
			}
			header {
				flex-shrink: 0;
			}
			main {
				flex-grow: 1;
				flex-shrink: 0;
			}
		</style>
    </head>
    <body>
        <div class="usa-overlay"></div>
        <header class="ncbi-header" role="banner" data-section="Header">
        <div class="usa-grid">
            <div class="usa-width-one-whole">
                
                <div class="ncbi-header__logo">
                    <a href="https://www.ncbi.nlm.nih.gov/" class="logo" aria-label="NCBI Logo">
                        <img src="https://www.ncbi.nlm.nih.gov/coreutils/nwds/img/logos/AgencyLogo.svg" alt="NIH NLM Logo"/>
                    </a>
                </div>
            </div>
        </div>
    </header>
    <main id="main_content">
     <section class="usa-section usa-grid">
        <h3><strong>Maintenance in progress</strong></h3>
        <p>
The page you are trying to reach is currently unavailable due to planned
maintenance. Most services will be unavailable for 24+ hours starting 9 PM EDT
on Friday, July 25, 2025.<br><br>
For more information, please visit
<a href="https://ncbiinsights.ncbi.nlm.nih.gov/2025/07/08/ncbi-website-maintenance-july-26th/">
NCBI Insights</a>
        </p>
     </section>
    </main>
    <footer>
       <section class="icon-selection">
          <div id="icon-section-header" class="icon-section_header">Follow NCBI</div>
            <div class="grid-container container">
              <div class="icon-section_container">
                <a class="footer-icon" id="footer_twitter" href="https://twitter.com/ncbi" aria-label="Twitter">
                    <svg width="40" height="40" viewBox="0 0 40 37" fill="none" xmlns="http://www.w3.org/2000/svg">
                        <title>Twitter</title>
                        <g id="twitterx1008">
                        <path id="path1008" d="M6.06736 7L16.8778 20.8991L6.00001 32.2H10.2L18.6 23.1L25.668 32.2H34L22.8 17.5L31.9 7H28.4L20.7 15.4L14.401 7H6.06898H6.06736ZM9.66753 8.73423H12.9327L29.7327 30.4658H26.5697L9.66753 8.73423Z" fill="#5B616B"></path> </g>
                    </svg>
                </a>
                <a class="footer-icon" id="footer_facebook" href="https://www.facebook.com/ncbi.nlm" aria-label="Facebook"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <title>Facebook</title>
                    <path class="cls-11" d="M210.5,115.12H171.74V97.82c0-8.14,5.39-10,9.19-10h27.14V52l-39.32-.12c-35.66,0-42.42,26.68-42.42,43.77v19.48H99.09v36.32h27.24v109h45.41v-109h35Z">
                    </path>
                  </svg></a>
                <a class="footer-icon" id="footer_linkedin" href="https://www.linkedin.com/company/ncbinlm" aria-label="LinkedIn"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <title>LinkedIn</title>
                    <path class="cls-11" d="M101.64,243.37H57.79v-114h43.85Zm-22-131.54h-.26c-13.25,0-21.82-10.36-21.82-21.76,0-11.65,8.84-21.15,22.33-21.15S101.7,78.72,102,90.38C102,101.77,93.4,111.83,79.63,111.83Zm100.93,52.61A17.54,17.54,0,0,0,163,182v61.39H119.18s.51-105.23,0-114H163v13a54.33,54.33,0,0,1,34.54-12.66c26,0,44.39,18.8,44.39,55.29v58.35H198.1V182A17.54,17.54,0,0,0,180.56,164.44Z">
                    </path>
                  </svg></a>
                <a class="footer-icon" id="footer_github" href="https://github.com/ncbi" aria-label="GitHub"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <defs>
                      <style>
                        .cls-11,
                        .cls-12 {
                          fill: #737373;
                        }

                        .cls-11 {
                          fill-rule: evenodd;
                        }
                      </style>
                    </defs>
                    <title>GitHub</title>
                    <path class="cls-11" d="M151.36,47.28a105.76,105.76,0,0,0-33.43,206.1c5.28,1,7.22-2.3,7.22-5.09,0-2.52-.09-10.85-.14-19.69-29.42,6.4-35.63-12.48-35.63-12.48-4.81-12.22-11.74-15.47-11.74-15.47-9.59-6.56.73-6.43.73-6.43,10.61.75,16.21,10.9,16.21,10.9,9.43,16.17,24.73,11.49,30.77,8.79,1-6.83,3.69-11.5,6.71-14.14C108.57,197.1,83.88,188,83.88,147.51a40.92,40.92,0,0,1,10.9-28.39c-1.1-2.66-4.72-13.42,1-28,0,0,8.88-2.84,29.09,10.84a100.26,100.26,0,0,1,53,0C198,88.3,206.9,91.14,206.9,91.14c5.76,14.56,2.14,25.32,1,28a40.87,40.87,0,0,1,10.89,28.39c0,40.62-24.74,49.56-48.29,52.18,3.79,3.28,7.17,9.71,7.17,19.58,0,14.15-.12,25.54-.12,29,0,2.82,1.9,6.11,7.26,5.07A105.76,105.76,0,0,0,151.36,47.28Z">
                    </path>
                    <path class="cls-12" d="M85.66,199.12c-.23.52-1.06.68-1.81.32s-1.2-1.06-.95-1.59,1.06-.69,1.82-.33,1.21,1.07.94,1.6Zm-1.3-1">
                    </path>
                    <path class="cls-12" d="M90,203.89c-.51.47-1.49.25-2.16-.49a1.61,1.61,0,0,1-.31-2.19c.52-.47,1.47-.25,2.17.49s.82,1.72.3,2.19Zm-1-1.08">
                    </path>
                    <path class="cls-12" d="M94.12,210c-.65.46-1.71,0-2.37-.91s-.64-2.07,0-2.52,1.7,0,2.36.89.65,2.08,0,2.54Zm0,0"></path>
                    <path class="cls-12" d="M99.83,215.87c-.58.64-1.82.47-2.72-.41s-1.18-2.06-.6-2.7,1.83-.46,2.74.41,1.2,2.07.58,2.7Zm0,0">
                    </path>
                    <path class="cls-12" d="M107.71,219.29c-.26.82-1.45,1.2-2.64.85s-2-1.34-1.74-2.17,1.44-1.23,2.65-.85,2,1.32,1.73,2.17Zm0,0">
                    </path>
                    <path class="cls-12" d="M116.36,219.92c0,.87-1,1.59-2.24,1.61s-2.29-.68-2.3-1.54,1-1.59,2.26-1.61,2.28.67,2.28,1.54Zm0,0">
                    </path>
                    <path class="cls-12" d="M124.42,218.55c.15.85-.73,1.72-2,1.95s-2.37-.3-2.52-1.14.73-1.75,2-2,2.37.29,2.53,1.16Zm0,0"></path>
                  </svg></a>
                <a class="footer-icon" id="footer_blog" href="https://ncbiinsights.ncbi.nlm.nih.gov/" aria-label="Blog">
                  <svg id="Layer_1" data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 40 40"><defs><style>.cls-1{fill:#737373;}</style></defs><path class="cls-1" d="M14,30a4,4,0,1,1-4-4,4,4,0,0,1,4,4Zm11,3A19,19,0,0,0,7.05,15a1,1,0,0,0-1,1v3a1,1,0,0,0,.93,1A14,14,0,0,1,20,33.07,1,1,0,0,0,21,34h3a1,1,0,0,0,1-1Zm9,0A28,28,0,0,0,7,6,1,1,0,0,0,6,7v3a1,1,0,0,0,1,1A23,23,0,0,1,29,33a1,1,0,0,0,1,1h3A1,1,0,0,0,34,33Z"></path></svg>
                </a>
              </div>
            </div>
        </section>
      <section class="container-fluid bg-primary">
        <div class="container pt-5">
          <div class="row mt-3">
            <div class="col-lg-3 col-12">
              <p><a class="text-white" href="https://www.nlm.nih.gov/socialmedia/index.html">Follow NLM</a></p>
              <ul class="list-inline social_media">
                  <li class="list-inline-item">
                      <a href="https://twitter.com/NLM_NIH" aria-label="Twitter" target="_blank" rel="noopener noreferrer">
                          <svg width="35" height="35" viewBox="0 0 38 35" fill="none" xmlns="http://www.w3.org/2000/svg">
                              <title>Twitter</title>
                              <g id="twitterx1009" clip-path="url(#clip0_65276_3946)">
                                 <path id="Vector" d="M17.5006 34.6565C26.9761 34.6565 34.6575 26.9751 34.6575 17.4996C34.6575 8.02416 26.9761 0.342773 17.5006 0.342773C8.02514 0.342773 0.34375 8.02416 0.34375 17.4996C0.34375 26.9751 8.02514 34.6565 17.5006 34.6565Z" fill="#205493" stroke="white" stroke-width="1.2" stroke-miterlimit="10"></path>
                                 <path id="path1009" d="M8.54811 8.5L16.2698 18.4279L8.50001 26.5H11.5L17.5 20L22.5486 26.5H28.5L20.5 16L27 8.5H24.5L19 14.5L14.5007 8.5H8.54927H8.54811ZM11.1197 9.73873H13.4519L25.4519 25.2613H23.1926L11.1197 9.73873Z" fill="white"></path>
                              </g>
                              <defs>
                              <clipPath id="clip0_65276_3946"> <rect width="38" height="38" fill="white"></rect> </clipPath>
                              </defs>
                          </svg>
                      </a>
                  </li>
                <li class="list-inline-item"><a href="https://www.facebook.com/nationallibraryofmedicine" aria-label="Facebook" rel="noopener noreferrer" target="_blank">
                  <svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" viewBox="0 0 249 249" style="enable-background:new 0 0 249 249;" xml:space="preserve">
                      <style type="text/css">
                        .st10 {
                          fill: #FFFFFF;
                        }

                        .st110 {
                          fill: none;
                          stroke: #FFFFFF;
                          stroke-width: 8;
                          stroke-miterlimit: 10;
                        }
                      </style>
                      <title>SM-Facebook</title>
                      <g>
                        <g>
                          <path class="st10" d="M159,99.1h-24V88.4c0-5,3.3-6.2,5.7-6.2h16.8V60l-24.4-0.1c-22.1,0-26.2,16.5-26.2,27.1v12.1H90v22.5h16.9
                                                      v67.5H135v-67.5h21.7L159,99.1z"></path>
                        </g>
                      </g>
                      <circle class="st110" cx="123.6" cy="123.2" r="108.2"></circle>
                    </svg>
                </a>
                </li>
                <li class="list-inline-item"><a href="https://www.youtube.com/user/NLMNIH" aria-label="Youtube" target="_blank" rel="noopener noreferrer"><svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" viewBox="0 0 249 249" style="enable-background:new 0 0 249 249;" xml:space="preserve">
                      <title>SM-Youtube</title>
                      <style type="text/css">
                        .st4 {
                          fill: none;
                          stroke: #FFFFFF;
                          stroke-width: 8;
                          stroke-miterlimit: 10;
                        }

                        .st5 {
                          fill: #FFFFFF;
                        }
                      </style>
                      <circle class="st4" cx="124.2" cy="123.4" r="108.2"></circle>
                      <g transform="translate(0,-952.36218)">
                        <path class="st5" d="M88.4,1037.4c-10.4,0-18.7,8.3-18.7,18.7v40.1c0,10.4,8.3,18.7,18.7,18.7h72.1c10.4,0,18.7-8.3,18.7-18.7
                                            v-40.1c0-10.4-8.3-18.7-18.7-18.7H88.4z M115.2,1058.8l29.4,17.4l-29.4,17.4V1058.8z"></path>
                      </g>
                    </svg></a></li>
              </ul>
            </div>
            <div class="col-lg-3 col-12">
              <p class="address_footer text-white">National Library of Medicine<br>
                <a href="https://www.google.com/maps/place/8600+Rockville+Pike,+Bethesda,+MD+20894/@38.9959508,-77.101021,17z/data=!3m1!4b1!4m5!3m4!1s0x89b7c95e25765ddb:0x19156f88b27635b8!8m2!3d38.9959508!4d-77.0988323" class="text-white" target="_blank" rel="noopener noreferrer">8600 Rockville Pike<br>
                  Bethesda, MD 20894</a></p>
            </div>
            <div class="col-lg-3 col-12 centered-lg">
              <p><a href="https://www.nlm.nih.gov/web_policies.html" class="text-white">Web Policies</a><br>
                <a href="https://www.nih.gov/institutes-nih/nih-office-director/office-communications-public-liaison/freedom-information-act-office" class="text-white">FOIA</a><br>
                <a href="https://www.hhs.gov/vulnerability-disclosure-policy/index.html" class="text-white" id="vdp">HHS Vulnerability Disclosure</a></p>
            </div>
            <div class="col-lg-3 col-12 centered-lg">
              <p><a class="supportLink text-white" href="https://support.nlm.nih.gov/">Help</a><br>
                <a href="https://www.nlm.nih.gov/accessibility.html" class="text-white">Accessibility</a><br>
                <a href="https://www.nlm.nih.gov/careers/careers.html" class="text-white">Careers</a></p>
            </div>
          </div>
          <div class="row">
            <div class="col-lg-12 centered-lg">
              <nav class="bottom-links">
                <ul class="mt-3">
                  <li>
                    <a class="text-white" href="https://www.nlm.nih.gov/">NLM</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.nih.gov/">NIH</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.hhs.gov/">HHS</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.usa.gov/">USA.gov</a>
                  </li>
                </ul>
              </nav>
            </div>
          </div>
        </div>
      </section>
    </footer>
    </body>
</html>
M  END
$$$$

✍: FYIcenter.com

2024-01-31, 1697👍, 0💬